C24H37N3O3 — CID 126490783
[(1R,4aS,6R,8aS)-2-(cyclopropylmethyl)-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]methylurea (PubChem CID 126490783) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is [(1R,4aS,6R,8aS)-2-(cyclopropylmethyl)-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]methylurea.
| Compound Name | [(1R,4aS,6R,8aS)-2-(cyclopropylmethyl)-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]methylurea |
|---|---|
| PubChem CID | 126490783 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | [(1R,4aS,6R,8aS)-2-(cyclopropylmethyl)-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]methylurea |
| SMILES | COc1ccc(C)c([C@]23CCN(CC4CC4)[C@H](C)[C@]2(O)CC[C@@H](CNC(N)=O)C3)c1 |
| InChI | InChI=1S/C24H37N3O3/c1-16-4-7-20(30-3)12-21(16)23-10-11-27(15-18-5-6-18)17(2)24(23,29)9-8-19(13-23)14-26-22(25)28/h4,7,12,17-19,29H,5-6,8-11,13-15H2,1-3H3,(H3,25,26,28)/t17-,19-,23-,24-/m1/s1 |
| InChIKey | CKXPNRIJLJAEEV-IBPUDULPSA-N |
| XLogP | 2.95 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |