C27H43N3O5 — CID 144643823
N-formyl-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-2-(oxan-4-ylmethyl)-3,4,5,6,7,8-hexahydro-1H-isoquinoline-6-carboxamide;methanamine (PubChem CID 144643823) has the molecular formula C27H43N3O5 and a molecular weight of 489.66 g/mol. Its IUPAC name is N-formyl-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-2-(oxan-4-ylmethyl)-3,4,5,6,7,8-hexahydro-1H-isoquinoline-6-carboxamide;methanamine.
| Compound Name | N-formyl-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-2-(oxan-4-ylmethyl)-3,4,5,6,7,8-hexahydro-1H-isoquinoline-6-carboxamide;methanamine |
|---|---|
| PubChem CID | 144643823 |
| Molecular Formula | C27H43N3O5 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | N-formyl-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-2-(oxan-4-ylmethyl)-3,4,5,6,7,8-hexahydro-1H-isoquinoline-6-carboxamide;methanamine |
| SMILES | CN.COc1ccc(C)c(C23CCN(CC4CCOCC4)C(C)C2(O)CCC(C(=O)NC=O)C3)c1 |
| InChI | InChI=1S/C26H38N2O5.CH5N/c1-18-4-5-22(32-3)14-23(18)25-10-11-28(16-20-7-12-33-13-8-20)19(2)26(25,31)9-6-21(15-25)24(30)27-17-29;1-2/h4-5,14,17,19-21,31H,6-13,15-16H2,1-3H3,(H,27,29,30);2H2,1H3 |
| InChIKey | VOMPDYJSJRKAQG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|