C27H36N2O4 — CID 144643706
(5aS,6R,9aR)-7-(cyclopropylmethyl)-5a-hydroxy-3-(methoxymethyl)-9a-(5-methoxy-2-methylphenyl)-6-methyl-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinolin-2-one (PubChem CID 144643706) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is (5aS,6R,9aR)-7-(cyclopropylmethyl)-5a-hydroxy-3-(methoxymethyl)-9a-(5-methoxy-2-methylphenyl)-6-methyl-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinolin-2-one.
| Compound Name | (5aS,6R,9aR)-7-(cyclopropylmethyl)-5a-hydroxy-3-(methoxymethyl)-9a-(5-methoxy-2-methylphenyl)-6-methyl-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinolin-2-one |
|---|---|
| PubChem CID | 144643706 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | (5aS,6R,9aR)-7-(cyclopropylmethyl)-5a-hydroxy-3-(methoxymethyl)-9a-(5-methoxy-2-methylphenyl)-6-methyl-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinolin-2-one |
| SMILES | COCc1cc2c([nH]c1=O)C[C@@]1(c3cc(OC)ccc3C)CCN(CC3CC3)[C@H](C)[C@]1(O)C2 |
| InChI | InChI=1S/C27H36N2O4/c1-17-5-8-22(33-4)12-23(17)26-9-10-29(15-19-6-7-19)18(2)27(26,31)13-20-11-21(16-32-3)25(30)28-24(20)14-26/h5,8,11-12,18-19,31H,6-7,9-10,13-16H2,1-4H3,(H,28,30)/t18-,26-,27-/m1/s1 |
| InChIKey | BNAVTKASJXEZID-PZYXKGHLSA-N |
| XLogP | 3.11 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |