C35H44N4O5 — CID 144643714
7-(cyclopropylmethyl)-5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-N-(1-phenylpropan-2-yl)-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide;formamide (PubChem CID 144643714) has the molecular formula C35H44N4O5 and a molecular weight of 600.76 g/mol. Its IUPAC name is 7-(cyclopropylmethyl)-5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-N-(1-phenylpropan-2-yl)-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide;formamide.
| Compound Name | 7-(cyclopropylmethyl)-5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-N-(1-phenylpropan-2-yl)-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide;formamide |
|---|---|
| PubChem CID | 144643714 |
| Molecular Formula | C35H44N4O5 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | 7-(cyclopropylmethyl)-5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-N-(1-phenylpropan-2-yl)-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide;formamide |
| SMILES | Cc1ccc(O)cc1C12CCN(CC3CC3)C(C)C1(O)Cc1cc(C(=O)NC(C)Cc3ccccc3)c(=O)[nH]c1C2.NC=O |
| InChI | InChI=1S/C34H41N3O4.CH3NO/c1-21-9-12-27(38)17-29(21)33-13-14-37(20-25-10-11-25)23(3)34(33,41)18-26-16-28(32(40)36-30(26)19-33)31(39)35-22(2)15-24-7-5-4-6-8-24;2-1-3/h4-9,12,16-17,22-23,25,38,41H,10-11,13-15,18-20H2,1-3H3,(H,35,39)(H,36,40);1H,(H2,2,3) |
| InChIKey | BGRQOGQTKJKTRH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 148.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|