C27H37N3O4 — CID 126489989
5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6,7-dimethyl-N-(3-methylbutyl)-2-oxo-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide (PubChem CID 126489989) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is 5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6,7-dimethyl-N-(3-methylbutyl)-2-oxo-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide.
| Compound Name | 5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6,7-dimethyl-N-(3-methylbutyl)-2-oxo-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 126489989 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | 5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6,7-dimethyl-N-(3-methylbutyl)-2-oxo-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide |
| SMILES | Cc1ccc(O)cc1C12CCN(C)C(C)C1(O)Cc1cc(C(=O)NCCC(C)C)c(=O)[nH]c1C2 |
| InChI | InChI=1S/C27H37N3O4/c1-16(2)8-10-28-24(32)21-12-19-14-27(34)18(4)30(5)11-9-26(27,15-23(19)29-25(21)33)22-13-20(31)7-6-17(22)3/h6-7,12-13,16,18,31,34H,8-11,14-15H2,1-5H3,(H,28,32)(H,29,33) |
| InChIKey | CMNKGSUXWHJGAL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |