C25H29N3O4 — CID 163795214
10,18-dihydroxy-N-(3-methylbutyl)-5-oxo-4,12-diazahexacyclo[12.6.1.01,10.03,8.011,14.015,20]henicosa-3(8),6,15(20),16,18-pentaene-6-carboxamide (PubChem CID 163795214) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 10,18-dihydroxy-N-(3-methylbutyl)-5-oxo-4,12-diazahexacyclo[12.6.1.01,10.03,8.011,14.015,20]henicosa-3(8),6,15(20),16,18-pentaene-6-carboxamide.
| Compound Name | 10,18-dihydroxy-N-(3-methylbutyl)-5-oxo-4,12-diazahexacyclo[12.6.1.01,10.03,8.011,14.015,20]henicosa-3(8),6,15(20),16,18-pentaene-6-carboxamide |
|---|---|
| PubChem CID | 163795214 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 10,18-dihydroxy-N-(3-methylbutyl)-5-oxo-4,12-diazahexacyclo[12.6.1.01,10.03,8.011,14.015,20]henicosa-3(8),6,15(20),16,18-pentaene-6-carboxamide |
| SMILES | CC(C)CCNC(=O)c1cc2c([nH]c1=O)CC13CC4(CNC4C1(O)C2)c1ccc(O)cc13 |
| InChI | InChI=1S/C25H29N3O4/c1-13(2)5-6-26-20(30)16-7-14-9-25(32)22-23(12-27-22)11-24(25,10-19(14)28-21(16)31)18-8-15(29)3-4-17(18)23/h3-4,7-8,13,22,27,29,32H,5-6,9-12H2,1-2H3,(H,26,30)(H,28,31) |
| InChIKey | NAEHGPSYAVKZHJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |