C26H31N3O4 — CID 90231109
(1R,10S,11R)-10-hydroxy-1-(5-hydroxy-2-methylphenyl)-12-methyl-6-(pyrrolidine-1-carbonyl)-4,12-diazatetracyclo[8.5.0.03,8.011,14]pentadeca-3(8),6-dien-5-one (PubChem CID 90231109) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is (1R,10S,11R)-10-hydroxy-1-(5-hydroxy-2-methylphenyl)-12-methyl-6-(pyrrolidine-1-carbonyl)-4,12-diazatetracyclo[8.5.0.03,8.011,14]pentadeca-3(8),6-dien-5-one.
| Compound Name | (1R,10S,11R)-10-hydroxy-1-(5-hydroxy-2-methylphenyl)-12-methyl-6-(pyrrolidine-1-carbonyl)-4,12-diazatetracyclo[8.5.0.03,8.011,14]pentadeca-3(8),6-dien-5-one |
|---|---|
| PubChem CID | 90231109 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | (1R,10S,11R)-10-hydroxy-1-(5-hydroxy-2-methylphenyl)-12-methyl-6-(pyrrolidine-1-carbonyl)-4,12-diazatetracyclo[8.5.0.03,8.011,14]pentadeca-3(8),6-dien-5-one |
| SMILES | Cc1ccc(O)cc1[C@@]12Cc3[nH]c(=O)c(C(=O)N4CCCC4)cc3C[C@@]1(O)[C@H]1C(CN1C)C2 |
| InChI | InChI=1S/C26H31N3O4/c1-15-5-6-18(30)10-20(15)25-11-17-14-28(2)22(17)26(25,33)12-16-9-19(23(31)27-21(16)13-25)24(32)29-7-3-4-8-29/h5-6,9-10,17,22,30,33H,3-4,7-8,11-14H2,1-2H3,(H,27,31)/t17?,22-,25-,26-/m1/s1 |
| InChIKey | XAIBEGRYIZCPSB-DFPYSMAISA-N |
| XLogP | 1.73 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |