C33H37N3O3 — CID 163596932
(5aR,6R)-7-(cyclopropylmethyl)-3-(1,3-dihydroisoindole-2-carbonyl)-9a-(5-hydroxy-2-methylphenyl)-6-methyl-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinolin-2-one (PubChem CID 163596932) has the molecular formula C33H37N3O3 and a molecular weight of 523.68 g/mol. Its IUPAC name is (5aR,6R)-7-(cyclopropylmethyl)-3-(1,3-dihydroisoindole-2-carbonyl)-9a-(5-hydroxy-2-methylphenyl)-6-methyl-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinolin-2-one.
| Compound Name | (5aR,6R)-7-(cyclopropylmethyl)-3-(1,3-dihydroisoindole-2-carbonyl)-9a-(5-hydroxy-2-methylphenyl)-6-methyl-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinolin-2-one |
|---|---|
| PubChem CID | 163596932 |
| Molecular Formula | C33H37N3O3 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | (5aR,6R)-7-(cyclopropylmethyl)-3-(1,3-dihydroisoindole-2-carbonyl)-9a-(5-hydroxy-2-methylphenyl)-6-methyl-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinolin-2-one |
| SMILES | Cc1ccc(O)cc1C12CCN(CC3CC3)[C@H](C)[C@@H]1Cc1cc(C(=O)N3Cc4ccccc4C3)c(=O)[nH]c1C2 |
| InChI | InChI=1S/C33H37N3O3/c1-20-7-10-26(37)15-28(20)33-11-12-35(17-22-8-9-22)21(2)29(33)14-25-13-27(31(38)34-30(25)16-33)32(39)36-18-23-5-3-4-6-24(23)19-36/h3-7,10,13,15,21-22,29,37H,8-9,11-12,14,16-19H2,1-2H3,(H,34,38)/t21-,29+,33?/m1/s1 |
| InChIKey | GUGAQJWFHHPMSM-XWVZZMIQSA-N |
| XLogP | 4.70 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |