C34H43N3O3 — CID 144643632
N-benzyl-7-(cyclopropylmethyl)-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxamide;ethane (PubChem CID 144643632) has the molecular formula C34H43N3O3 and a molecular weight of 541.74 g/mol. Its IUPAC name is N-benzyl-7-(cyclopropylmethyl)-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxamide;ethane.
| Compound Name | N-benzyl-7-(cyclopropylmethyl)-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxamide;ethane |
|---|---|
| PubChem CID | 144643632 |
| Molecular Formula | C34H43N3O3 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | N-benzyl-7-(cyclopropylmethyl)-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxamide;ethane |
| SMILES | CC.Cc1ccc(O)cc1C12CCN(CC3CC3)C(C)C1Cc1cc(C(=O)NCc3ccccc3)c(=O)[nH]c1C2 |
| InChI | InChI=1S/C32H37N3O3.C2H6/c1-20-8-11-25(36)16-27(20)32-12-13-35(19-23-9-10-23)21(2)28(32)15-24-14-26(31(38)34-29(24)17-32)30(37)33-18-22-6-4-3-5-7-22;1-2/h3-8,11,14,16,21,23,28,36H,9-10,12-13,15,17-19H2,1-2H3,(H,33,37)(H,34,38);1-2H3 |
| InChIKey | UWFAKILCDYILEV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |