C24H26N2O4 — CID 139271649
21-(cyclopropylmethyl)-16-hydroxy-5-oxo-4,21-diazapentacyclo[9.7.3.01,10.03,8.013,18]henicosa-3(8),6,13(18),14,16-pentaene-6-carboxylic acid (PubChem CID 139271649) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 21-(cyclopropylmethyl)-16-hydroxy-5-oxo-4,21-diazapentacyclo[9.7.3.01,10.03,8.013,18]henicosa-3(8),6,13(18),14,16-pentaene-6-carboxylic acid.
| Compound Name | 21-(cyclopropylmethyl)-16-hydroxy-5-oxo-4,21-diazapentacyclo[9.7.3.01,10.03,8.013,18]henicosa-3(8),6,13(18),14,16-pentaene-6-carboxylic acid |
|---|---|
| PubChem CID | 139271649 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 21-(cyclopropylmethyl)-16-hydroxy-5-oxo-4,21-diazapentacyclo[9.7.3.01,10.03,8.013,18]henicosa-3(8),6,13(18),14,16-pentaene-6-carboxylic acid |
| SMILES | O=C(O)c1cc2c([nH]c1=O)CC13CCN(CC4CC4)C(Cc4ccc(O)cc41)C3C2 |
| InChI | InChI=1S/C24H26N2O4/c27-16-4-3-14-9-21-19-8-15-7-17(23(29)30)22(28)25-20(15)11-24(19,18(14)10-16)5-6-26(21)12-13-1-2-13/h3-4,7,10,13,19,21,27H,1-2,5-6,8-9,11-12H2,(H,25,28)(H,29,30) |
| InChIKey | VYLMXAIDANNJAZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |