C25H30N2O4 — CID 123217052
7-(cyclopropylmethyl)-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxylic acid (PubChem CID 123217052) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 7-(cyclopropylmethyl)-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxylic acid.
| Compound Name | 7-(cyclopropylmethyl)-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 123217052 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 7-(cyclopropylmethyl)-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxylic acid |
| SMILES | Cc1ccc(O)cc1C12CCN(CC3CC3)C(C)C1Cc1cc(C(=O)O)c(=O)[nH]c1C2 |
| InChI | InChI=1S/C25H30N2O4/c1-14-3-6-18(28)11-20(14)25-7-8-27(13-16-4-5-16)15(2)21(25)10-17-9-19(24(30)31)23(29)26-22(17)12-25/h3,6,9,11,15-16,21,28H,4-5,7-8,10,12-13H2,1-2H3,(H,26,29)(H,30,31) |
| InChIKey | XHCLYRPVAUKWPX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |