C26H33N3O3 — CID 144643576
7-(cyclopropylmethyl)-9a-(5-hydroxy-2-methylphenyl)-5a,6-dimethyl-2-oxo-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide (PubChem CID 144643576) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 7-(cyclopropylmethyl)-9a-(5-hydroxy-2-methylphenyl)-5a,6-dimethyl-2-oxo-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide.
| Compound Name | 7-(cyclopropylmethyl)-9a-(5-hydroxy-2-methylphenyl)-5a,6-dimethyl-2-oxo-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 144643576 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 7-(cyclopropylmethyl)-9a-(5-hydroxy-2-methylphenyl)-5a,6-dimethyl-2-oxo-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide |
| SMILES | Cc1ccc(O)cc1C12CCN(CC3CC3)C(C)C1(C)Cc1cc(C(N)=O)c(=O)[nH]c1C2 |
| InChI | InChI=1S/C26H33N3O3/c1-15-4-7-19(30)11-21(15)26-8-9-29(14-17-5-6-17)16(2)25(26,3)12-18-10-20(23(27)31)24(32)28-22(18)13-26/h4,7,10-11,16-17,30H,5-6,8-9,12-14H2,1-3H3,(H2,27,31)(H,28,32) |
| InChIKey | OBKIYQCAUXBMGM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |