C32H36N2O4 — CID 144643582
3-benzoyl-7-(cyclopropylmethyl)-5a-hydroxy-9a-(5-methoxy-2-methylphenyl)-6-methyl-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinolin-2-one (PubChem CID 144643582) has the molecular formula C32H36N2O4 and a molecular weight of 512.65 g/mol. Its IUPAC name is 3-benzoyl-7-(cyclopropylmethyl)-5a-hydroxy-9a-(5-methoxy-2-methylphenyl)-6-methyl-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinolin-2-one.
| Compound Name | 3-benzoyl-7-(cyclopropylmethyl)-5a-hydroxy-9a-(5-methoxy-2-methylphenyl)-6-methyl-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinolin-2-one |
|---|---|
| PubChem CID | 144643582 |
| Molecular Formula | C32H36N2O4 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 3-benzoyl-7-(cyclopropylmethyl)-5a-hydroxy-9a-(5-methoxy-2-methylphenyl)-6-methyl-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinolin-2-one |
| SMILES | COc1ccc(C)c(C23CCN(CC4CC4)C(C)C2(O)Cc2cc(C(=O)c4ccccc4)c(=O)[nH]c2C3)c1 |
| InChI | InChI=1S/C32H36N2O4/c1-20-9-12-25(38-3)16-27(20)31-13-14-34(19-22-10-11-22)21(2)32(31,37)17-24-15-26(30(36)33-28(24)18-31)29(35)23-7-5-4-6-8-23/h4-9,12,15-16,21-22,37H,10-11,13-14,17-19H2,1-3H3,(H,33,36) |
| InChIKey | KWXLQQHNCNXVRB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |