C22H27N3O4 — CID 144643650
(5aS,6R,9aR)-5a-hydroxy-9a-(5-methoxy-2-methylphenyl)-6-methyl-2-oxo-5,6,7,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxamide (PubChem CID 144643650) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is (5aS,6R,9aR)-5a-hydroxy-9a-(5-methoxy-2-methylphenyl)-6-methyl-2-oxo-5,6,7,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxamide.
| Compound Name | (5aS,6R,9aR)-5a-hydroxy-9a-(5-methoxy-2-methylphenyl)-6-methyl-2-oxo-5,6,7,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 144643650 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (5aS,6R,9aR)-5a-hydroxy-9a-(5-methoxy-2-methylphenyl)-6-methyl-2-oxo-5,6,7,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxamide |
| SMILES | COc1ccc(C)c([C@]23CCN[C@H](C)[C@]2(O)Cc2cc(C(N)=O)c(=O)[nH]c2C3)c1 |
| InChI | InChI=1S/C22H27N3O4/c1-12-4-5-15(29-3)9-17(12)21-6-7-24-13(2)22(21,28)10-14-8-16(19(23)26)20(27)25-18(14)11-21/h4-5,8-9,13,24,28H,6-7,10-11H2,1-3H3,(H2,23,26)(H,25,27)/t13-,21-,22-/m1/s1 |
| InChIKey | IDVGUEVSHGMARW-NBQKENEESA-N |
| XLogP | 0.94 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |