C28H38N2O4 — CID 123796273
methyl 9a-(5-methoxy-2-methylphenyl)-6-methyl-7-(2-methylbutyl)-2-oxo-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxylate (PubChem CID 123796273) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is methyl 9a-(5-methoxy-2-methylphenyl)-6-methyl-7-(2-methylbutyl)-2-oxo-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxylate.
| Compound Name | methyl 9a-(5-methoxy-2-methylphenyl)-6-methyl-7-(2-methylbutyl)-2-oxo-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 123796273 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | methyl 9a-(5-methoxy-2-methylphenyl)-6-methyl-7-(2-methylbutyl)-2-oxo-5,5a,6,8,9,10-hexahydro-1H-pyrido[3,4-g]quinoline-3-carboxylate |
| SMILES | CCC(C)CN1CCC2(c3cc(OC)ccc3C)Cc3[nH]c(=O)c(C(=O)OC)cc3CC2C1C |
| InChI | InChI=1S/C28H38N2O4/c1-7-17(2)16-30-11-10-28(23-14-21(33-5)9-8-18(23)3)15-25-20(13-24(28)19(30)4)12-22(26(31)29-25)27(32)34-6/h8-9,12,14,17,19,24H,7,10-11,13,15-16H2,1-6H3,(H,29,31) |
| InChIKey | ZRYSYXGTIVRNSL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |