C25H32N2O5 — CID 144978545
1-ethyl-5a-hydroxy-9a-(5-methoxy-2-methylphenyl)-6,7-dimethyl-2-oxo-6,8,9,10-tetrahydro-5H-pyrido[3,4-g]quinoline-3-carboxylic acid (PubChem CID 144978545) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-ethyl-5a-hydroxy-9a-(5-methoxy-2-methylphenyl)-6,7-dimethyl-2-oxo-6,8,9,10-tetrahydro-5H-pyrido[3,4-g]quinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-5a-hydroxy-9a-(5-methoxy-2-methylphenyl)-6,7-dimethyl-2-oxo-6,8,9,10-tetrahydro-5H-pyrido[3,4-g]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 144978545 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 1-ethyl-5a-hydroxy-9a-(5-methoxy-2-methylphenyl)-6,7-dimethyl-2-oxo-6,8,9,10-tetrahydro-5H-pyrido[3,4-g]quinoline-3-carboxylic acid |
| SMILES | CCn1c2c(cc(C(=O)O)c1=O)CC1(O)C(C)N(C)CCC1(c1cc(OC)ccc1C)C2 |
| InChI | InChI=1S/C25H32N2O5/c1-6-27-21-14-24(20-12-18(32-5)8-7-15(20)2)9-10-26(4)16(3)25(24,31)13-17(21)11-19(22(27)28)23(29)30/h7-8,11-12,16,31H,6,9-10,13-14H2,1-5H3,(H,29,30) |
| InChIKey | VOGFXJXHRIKFRY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |