C25H35N3O4 — CID 126490590
(1R,4aR,6S,8aS)-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-2-(3-methylbut-2-enyl)spiro[1,3,4,5,7,8-hexahydroisoquinoline-6,5'-imidazolidine]-2',4'-dione (PubChem CID 126490590) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is (1R,4aR,6S,8aS)-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-2-(3-methylbut-2-enyl)spiro[1,3,4,5,7,8-hexahydroisoquinoline-6,5'-imidazolidine]-2',4'-dione.
| Compound Name | (1R,4aR,6S,8aS)-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-2-(3-methylbut-2-enyl)spiro[1,3,4,5,7,8-hexahydroisoquinoline-6,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 126490590 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | (1R,4aR,6S,8aS)-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-2-(3-methylbut-2-enyl)spiro[1,3,4,5,7,8-hexahydroisoquinoline-6,5'-imidazolidine]-2',4'-dione |
| SMILES | COc1ccc(C)c([C@]23CCN(CC=C(C)C)[C@H](C)[C@]2(O)CC[C@@]2(C3)NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C25H35N3O4/c1-16(2)8-12-28-13-11-23(20-14-19(32-5)7-6-17(20)3)15-24(21(29)26-22(30)27-24)9-10-25(23,31)18(28)4/h6-8,14,18,31H,9-13,15H2,1-5H3,(H2,26,27,29,30)/t18-,23-,24+,25-/m1/s1 |
| InChIKey | CCCXZFDGJYLZFV-FUJBWUKOSA-N |
| XLogP | 2.80 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|