C24H35NO4 — CID 123696708
2-(cyclopropylmethyl)-8a-hydroxy-7-(2-hydroxyethyl)-4a-(5-methoxy-2-methylphenyl)-1-methyl-1,3,4,5,7,8-hexahydroisoquinolin-6-one (PubChem CID 123696708) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-8a-hydroxy-7-(2-hydroxyethyl)-4a-(5-methoxy-2-methylphenyl)-1-methyl-1,3,4,5,7,8-hexahydroisoquinolin-6-one.
| Compound Name | 2-(cyclopropylmethyl)-8a-hydroxy-7-(2-hydroxyethyl)-4a-(5-methoxy-2-methylphenyl)-1-methyl-1,3,4,5,7,8-hexahydroisoquinolin-6-one |
|---|---|
| PubChem CID | 123696708 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 2-(cyclopropylmethyl)-8a-hydroxy-7-(2-hydroxyethyl)-4a-(5-methoxy-2-methylphenyl)-1-methyl-1,3,4,5,7,8-hexahydroisoquinolin-6-one |
| SMILES | COc1ccc(C)c(C23CCN(CC4CC4)C(C)C2(O)CC(CCO)C(=O)C3)c1 |
| InChI | InChI=1S/C24H35NO4/c1-16-4-7-20(29-3)12-21(16)23-9-10-25(15-18-5-6-18)17(2)24(23,28)13-19(8-11-26)22(27)14-23/h4,7,12,17-19,26,28H,5-6,8-11,13-15H2,1-3H3 |
| InChIKey | FOPHSCFJFQAZPC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |