C27H41N3O4 — CID 126490365
N-carbamoyl-2-(cyclohexylmethyl)-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinoline-6-carboxamide (PubChem CID 126490365) has the molecular formula C27H41N3O4 and a molecular weight of 471.64 g/mol. Its IUPAC name is N-carbamoyl-2-(cyclohexylmethyl)-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinoline-6-carboxamide.
| Compound Name | N-carbamoyl-2-(cyclohexylmethyl)-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 126490365 |
| Molecular Formula | C27H41N3O4 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.31 |
| IUPAC Name | N-carbamoyl-2-(cyclohexylmethyl)-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinoline-6-carboxamide |
| SMILES | COc1ccc(C)c(C23CCN(CC4CCCCC4)C(C)C2(O)CCC(C(=O)NC(N)=O)C3)c1 |
| InChI | InChI=1S/C27H41N3O4/c1-18-9-10-22(34-3)15-23(18)26-13-14-30(17-20-7-5-4-6-8-20)19(2)27(26,33)12-11-21(16-26)24(31)29-25(28)32/h9-10,15,19-21,33H,4-8,11-14,16-17H2,1-3H3,(H3,28,29,31,32) |
| InChIKey | AFRFRCSCJPJMBT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |