C26H39N3O4 — CID 144643769
(4aS)-N-carbamoyl-2-(cyclopropylmethyl)-N-ethyl-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinoline-6-carboxamide (PubChem CID 144643769) has the molecular formula C26H39N3O4 and a molecular weight of 457.62 g/mol. Its IUPAC name is (4aS)-N-carbamoyl-2-(cyclopropylmethyl)-N-ethyl-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinoline-6-carboxamide.
| Compound Name | (4aS)-N-carbamoyl-2-(cyclopropylmethyl)-N-ethyl-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 144643769 |
| Molecular Formula | C26H39N3O4 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | (4aS)-N-carbamoyl-2-(cyclopropylmethyl)-N-ethyl-8a-hydroxy-4a-(5-methoxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinoline-6-carboxamide |
| SMILES | CCN(C(N)=O)C(=O)C1CCC2(O)C(C)N(CC3CC3)CC[C@]2(c2cc(OC)ccc2C)C1 |
| InChI | InChI=1S/C26H39N3O4/c1-5-29(24(27)31)23(30)20-10-11-26(32)18(3)28(16-19-7-8-19)13-12-25(26,15-20)22-14-21(33-4)9-6-17(22)2/h6,9,14,18-20,32H,5,7-8,10-13,15-16H2,1-4H3,(H2,27,31)/t18?,20?,25-,26?/m1/s1 |
| InChIKey | YMUATOQRJUDEGO-RJIDXAQLSA-N |
| XLogP | 3.20 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |