C24H36N2O4 — CID 144877009
N-[(4aR,7S)-2-(cyclopropylmethyl)-6,8a-dihydroxy-4a-(5-hydroxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-7-yl]propanamide (PubChem CID 144877009) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is N-[(4aR,7S)-2-(cyclopropylmethyl)-6,8a-dihydroxy-4a-(5-hydroxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-7-yl]propanamide.
| Compound Name | N-[(4aR,7S)-2-(cyclopropylmethyl)-6,8a-dihydroxy-4a-(5-hydroxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-7-yl]propanamide |
|---|---|
| PubChem CID | 144877009 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | N-[(4aR,7S)-2-(cyclopropylmethyl)-6,8a-dihydroxy-4a-(5-hydroxy-2-methylphenyl)-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-7-yl]propanamide |
| SMILES | CCC(=O)N[C@H]1CC2(O)C(C)N(CC3CC3)CC[C@]2(c2cc(O)ccc2C)CC1O |
| InChI | InChI=1S/C24H36N2O4/c1-4-22(29)25-20-12-24(30)16(3)26(14-17-6-7-17)10-9-23(24,13-21(20)28)19-11-18(27)8-5-15(19)2/h5,8,11,16-17,20-21,27-28,30H,4,6-7,9-10,12-14H2,1-3H3,(H,25,29)/t16?,20-,21?,23+,24?/m0/s1 |
| InChIKey | BKMQAPGFHIPXPQ-GRHKTECWSA-N |
| XLogP | 2.22 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |