C31H45N3O4 — CID 144643715
N-(cyclohexylmethyl)-5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6,7-dimethyl-2-oxo-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide;ethane (PubChem CID 144643715) has the molecular formula C31H45N3O4 and a molecular weight of 523.72 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6,7-dimethyl-2-oxo-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide;ethane.
| Compound Name | N-(cyclohexylmethyl)-5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6,7-dimethyl-2-oxo-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide;ethane |
|---|---|
| PubChem CID | 144643715 |
| Molecular Formula | C31H45N3O4 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.34 |
| IUPAC Name | N-(cyclohexylmethyl)-5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6,7-dimethyl-2-oxo-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide;ethane |
| SMILES | CC.Cc1ccc(O)cc1C12CCN(C)C(C)C1(O)Cc1cc(C(=O)NCC3CCCCC3)c(=O)[nH]c1C2 |
| InChI | InChI=1S/C29H39N3O4.C2H6/c1-18-9-10-22(33)14-24(18)28-11-12-32(3)19(2)29(28,36)15-21-13-23(27(35)31-25(21)16-28)26(34)30-17-20-7-5-4-6-8-20;1-2/h9-10,13-14,19-20,33,36H,4-8,11-12,15-17H2,1-3H3,(H,30,34)(H,31,35);1-2H3 |
| InChIKey | ZGUSHQSLGSTZDV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |