C24H30F3N3O4S — CID 144643674
(9aR)-5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-7-(2,2,2-trifluoroethyl)-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide;methanethiol (PubChem CID 144643674) has the molecular formula C24H30F3N3O4S and a molecular weight of 513.58 g/mol. Its IUPAC name is (9aR)-5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-7-(2,2,2-trifluoroethyl)-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide;methanethiol.
| Compound Name | (9aR)-5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-7-(2,2,2-trifluoroethyl)-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide;methanethiol |
|---|---|
| PubChem CID | 144643674 |
| Molecular Formula | C24H30F3N3O4S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | (9aR)-5a-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6-methyl-2-oxo-7-(2,2,2-trifluoroethyl)-1,5,6,8,9,10-hexahydropyrido[3,4-g]quinoline-3-carboxamide;methanethiol |
| SMILES | CS.Cc1ccc(O)cc1[C@]12CCN(CC(F)(F)F)C(C)C1(O)Cc1cc(C(N)=O)c(=O)[nH]c1C2 |
| InChI | InChI=1S/C23H26F3N3O4.CH4S/c1-12-3-4-15(30)8-17(12)21-5-6-29(11-23(24,25)26)13(2)22(21,33)9-14-7-16(19(27)31)20(32)28-18(14)10-21;1-2/h3-4,7-8,13,30,33H,5-6,9-11H2,1-2H3,(H2,27,31)(H,28,32);2H,1H3/t13?,21-,22?;/m1./s1 |
| InChIKey | GYTQWAQUZPBJJL-SPPGOFHNSA-N |
| XLogP | 2.46 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|