C30H30N2O4 — CID 90255496
(10S,11R)-6-benzoyl-21-(cyclopropylmethyl)-10,16-dihydroxy-4,21-diazapentacyclo[9.7.3.01,10.03,8.013,18]henicosa-3(8),6,13(18),14,16-pentaen-5-one (PubChem CID 90255496) has the molecular formula C30H30N2O4 and a molecular weight of 482.60 g/mol. Its IUPAC name is (10S,11R)-6-benzoyl-21-(cyclopropylmethyl)-10,16-dihydroxy-4,21-diazapentacyclo[9.7.3.01,10.03,8.013,18]henicosa-3(8),6,13(18),14,16-pentaen-5-one.
| Compound Name | (10S,11R)-6-benzoyl-21-(cyclopropylmethyl)-10,16-dihydroxy-4,21-diazapentacyclo[9.7.3.01,10.03,8.013,18]henicosa-3(8),6,13(18),14,16-pentaen-5-one |
|---|---|
| PubChem CID | 90255496 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (10S,11R)-6-benzoyl-21-(cyclopropylmethyl)-10,16-dihydroxy-4,21-diazapentacyclo[9.7.3.01,10.03,8.013,18]henicosa-3(8),6,13(18),14,16-pentaen-5-one |
| SMILES | C1CC1CN2CCC34CC5=C(C[C@]3([C@H]2CC6=C4C=C(C=C6)O)O)C=C(C(=O)N5)C(=O)C7=CC=CC=C7 |
| InChI | InChI=1S/C30H30N2O4/c33-22-9-8-20-13-26-30(36)15-21-12-23(27(34)19-4-2-1-3-5-19)28(35)31-25(21)16-29(30,24(20)14-22)10-11-32(26)17-18-6-7-18/h1-5,8-9,12,14,18,26,33,36H,6-7,10-11,13,15-17H2,(H,31,35)/t26-,29?,30-/m1/s1 |
| InChIKey | TURSCWSSBGVKID-PGEZTSDDSA-N |
| XLogP | 3.20 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | 1020 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |