C29H39N3O3 — CID 126489976
[(6R)-7-(cyclopropylmethyl)-2-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6-methyl-1,2,5,5a,6,8,9,10-octahydropyrido[3,4-g]quinolin-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 126489976) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is [(6R)-7-(cyclopropylmethyl)-2-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6-methyl-1,2,5,5a,6,8,9,10-octahydropyrido[3,4-g]quinolin-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(6R)-7-(cyclopropylmethyl)-2-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6-methyl-1,2,5,5a,6,8,9,10-octahydropyrido[3,4-g]quinolin-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 126489976 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | [(6R)-7-(cyclopropylmethyl)-2-hydroxy-9a-(5-hydroxy-2-methylphenyl)-6-methyl-1,2,5,5a,6,8,9,10-octahydropyrido[3,4-g]quinolin-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1ccc(O)cc1C12CCN(CC3CC3)[C@H](C)C1CC1=C(C2)NC(O)C(C(=O)N2CCCC2)=C1 |
| InChI | InChI=1S/C29H39N3O3/c1-18-5-8-22(33)15-24(18)29-9-12-32(17-20-6-7-20)19(2)25(29)14-21-13-23(27(34)30-26(21)16-29)28(35)31-10-3-4-11-31/h5,8,13,15,19-20,25,27,30,33-34H,3-4,6-7,9-12,14,16-17H2,1-2H3/t19-,25?,27?,29?/m1/s1 |
| InChIKey | ZWYDHPQRODYIAA-YBKFYWRHSA-N |
| XLogP | 3.58 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |