C23H34N2O3 — CID 126581632
2-[(4aR)-7-(cyclopropylmethyl)-4a-(2-ethyl-5-hydroxyphenyl)-8-methyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]acetic acid (PubChem CID 126581632) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is 2-[(4aR)-7-(cyclopropylmethyl)-4a-(2-ethyl-5-hydroxyphenyl)-8-methyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]acetic acid.
| Compound Name | 2-[(4aR)-7-(cyclopropylmethyl)-4a-(2-ethyl-5-hydroxyphenyl)-8-methyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]acetic acid |
|---|---|
| PubChem CID | 126581632 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 2-[(4aR)-7-(cyclopropylmethyl)-4a-(2-ethyl-5-hydroxyphenyl)-8-methyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]acetic acid |
| SMILES | CCc1ccc(O)cc1[C@@]12CCN(CC(=O)O)CC1C(C)N(CC1CC1)CC2 |
| InChI | InChI=1S/C23H34N2O3/c1-3-18-6-7-19(26)12-20(18)23-8-10-24(15-22(27)28)14-21(23)16(2)25(11-9-23)13-17-4-5-17/h6-7,12,16-17,21,26H,3-5,8-11,13-15H2,1-2H3,(H,27,28)/t16?,21?,23-/m0/s1 |
| InChIKey | PNMQUOIQPHPIBA-WWRGRJRASA-N |
| XLogP | 3.10 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |