C23H32N2O3 — CID 90224457
methyl 2-[(1R,9R,10S)-17-(cyclopropylmethyl)-4-methoxy-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]acetate (PubChem CID 90224457) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is methyl 2-[(1R,9R,10S)-17-(cyclopropylmethyl)-4-methoxy-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]acetate.
| Compound Name | methyl 2-[(1R,9R,10S)-17-(cyclopropylmethyl)-4-methoxy-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]acetate |
|---|---|
| PubChem CID | 90224457 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | methyl 2-[(1R,9R,10S)-17-(cyclopropylmethyl)-4-methoxy-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]acetate |
| SMILES | COC(=O)CN1CC[C@]23CCN(CC4CC4)[C@H](Cc4ccc(OC)cc42)[C@@H]3C1 |
| InChI | InChI=1S/C23H32N2O3/c1-27-18-6-5-17-11-21-20-14-24(15-22(26)28-2)9-7-23(20,19(17)12-18)8-10-25(21)13-16-3-4-16/h5-6,12,16,20-21H,3-4,7-11,13-15H2,1-2H3/t20-,21+,23-/m0/s1 |
| InChIKey | FXEABPXFVJBWJT-XJUOHMSHSA-N |
| XLogP | 2.47 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |