C23H33NO — CID 46877943
(1R,9R,11S)-17-(cyclopropylmethyl)-11-ethyl-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 46877943) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is (1R,9R,11S)-17-(cyclopropylmethyl)-11-ethyl-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1R,9R,11S)-17-(cyclopropylmethyl)-11-ethyl-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 46877943 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | (1R,9R,11S)-17-(cyclopropylmethyl)-11-ethyl-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | CCC1CCC[C@]23CCN(CC4CC4)[C@H](Cc4ccc(OC)cc42)C13 |
| InChI | InChI=1S/C23H33NO/c1-3-17-5-4-10-23-11-12-24(15-16-6-7-16)21(22(17)23)13-18-8-9-19(25-2)14-20(18)23/h8-9,14,16-17,21-22H,3-7,10-13,15H2,1-2H3/t17?,21-,22?,23+/m1/s1 |
| InChIKey | QWQKLVIKUXAYET-HQGPSQQTSA-N |
| XLogP | 4.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |