C25H37NO — CID 46877964
(1R,9R,11S)-17-(cyclobutylmethyl)-11-ethyl-4-methoxy-12-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 46877964) has the molecular formula C25H37NO and a molecular weight of 367.58 g/mol. Its IUPAC name is (1R,9R,11S)-17-(cyclobutylmethyl)-11-ethyl-4-methoxy-12-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1R,9R,11S)-17-(cyclobutylmethyl)-11-ethyl-4-methoxy-12-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 46877964 |
| Molecular Formula | C25H37NO |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | (1R,9R,11S)-17-(cyclobutylmethyl)-11-ethyl-4-methoxy-12-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | CCC1C(C)CC[C@]23CCN(CC4CCC4)[C@H](Cc4ccc(OC)cc42)C13 |
| InChI | InChI=1S/C25H37NO/c1-4-21-17(2)10-11-25-12-13-26(16-18-6-5-7-18)23(24(21)25)14-19-8-9-20(27-3)15-22(19)25/h8-9,15,17-18,21,23-24H,4-7,10-14,16H2,1-3H3/t17?,21?,23-,24?,25+/m1/s1 |
| InChIKey | GBDVUTUHHVNACT-PPQAVTQKSA-N |
| XLogP | 5.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |