C34H51N3O3 — CID 144643570
(E)-3-[2-(cyclopropylmethyl)-6-formamido-4a-(5-hydroxy-2-methylphenyl)-1-methyl-1,3,4,5,8,8a-hexahydroisoquinolin-7-yl]-N-heptan-4-yl-N,2-dimethylprop-2-enamide (PubChem CID 144643570) has the molecular formula C34H51N3O3 and a molecular weight of 549.80 g/mol. Its IUPAC name is (E)-3-[2-(cyclopropylmethyl)-6-formamido-4a-(5-hydroxy-2-methylphenyl)-1-methyl-1,3,4,5,8,8a-hexahydroisoquinolin-7-yl]-N-heptan-4-yl-N,2-dimethylprop-2-enamide.
| Compound Name | (E)-3-[2-(cyclopropylmethyl)-6-formamido-4a-(5-hydroxy-2-methylphenyl)-1-methyl-1,3,4,5,8,8a-hexahydroisoquinolin-7-yl]-N-heptan-4-yl-N,2-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 144643570 |
| Molecular Formula | C34H51N3O3 |
| Molecular Weight | 549.80 g/mol |
| Exact Mass | 549.39 |
| IUPAC Name | (E)-3-[2-(cyclopropylmethyl)-6-formamido-4a-(5-hydroxy-2-methylphenyl)-1-methyl-1,3,4,5,8,8a-hexahydroisoquinolin-7-yl]-N-heptan-4-yl-N,2-dimethylprop-2-enamide |
| SMILES | CCCC(CCC)N(C)C(=O)/C(C)=C/C1=C(NC=O)CC2(c3cc(O)ccc3C)CCN(CC3CC3)C(C)C2C1 |
| InChI | InChI=1S/C34H51N3O3/c1-7-9-28(10-8-2)36(6)33(40)24(4)17-27-18-31-25(5)37(21-26-12-13-26)16-15-34(31,20-32(27)35-22-38)30-19-29(39)14-11-23(30)3/h11,14,17,19,22,25-26,28,31,39H,7-10,12-13,15-16,18,20-21H2,1-6H3,(H,35,38)/b24-17+ |
| InChIKey | WBFRYLVKDXYKOT-JJIBRWJFSA-N |
| XLogP | 6.23 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.80 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|