C25H35N3O4 — CID 144643738
(E)-3-[6-formamido-8a-hydroxy-4a-(5-hydroxy-2-methylphenyl)-1,2-dimethyl-3,4,5,8-tetrahydro-1H-isoquinolin-7-yl]-N,N,2-trimethylprop-2-enamide (PubChem CID 144643738) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is (E)-3-[6-formamido-8a-hydroxy-4a-(5-hydroxy-2-methylphenyl)-1,2-dimethyl-3,4,5,8-tetrahydro-1H-isoquinolin-7-yl]-N,N,2-trimethylprop-2-enamide.
| Compound Name | (E)-3-[6-formamido-8a-hydroxy-4a-(5-hydroxy-2-methylphenyl)-1,2-dimethyl-3,4,5,8-tetrahydro-1H-isoquinolin-7-yl]-N,N,2-trimethylprop-2-enamide |
|---|---|
| PubChem CID | 144643738 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | (E)-3-[6-formamido-8a-hydroxy-4a-(5-hydroxy-2-methylphenyl)-1,2-dimethyl-3,4,5,8-tetrahydro-1H-isoquinolin-7-yl]-N,N,2-trimethylprop-2-enamide |
| SMILES | C/C(=C\C1=C(NC=O)CC2(c3cc(O)ccc3C)CCN(C)C(C)C2(O)C1)C(=O)N(C)C |
| InChI | InChI=1S/C25H35N3O4/c1-16-7-8-20(30)12-21(16)24-9-10-28(6)18(3)25(24,32)13-19(22(14-24)26-15-29)11-17(2)23(31)27(4)5/h7-8,11-12,15,18,30,32H,9-10,13-14H2,1-6H3,(H,26,29)/b17-11+ |
| InChIKey | PHQZTMJBMGVNBN-GZTJUZNOSA-N |
| XLogP | 2.22 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|