C19H27NO3 — CID 142397468
3-(8a-hydroxy-1,2-dimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl)-4-methylbenzoic acid (PubChem CID 142397468) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-(8a-hydroxy-1,2-dimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl)-4-methylbenzoic acid.
| Compound Name | 3-(8a-hydroxy-1,2-dimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl)-4-methylbenzoic acid |
|---|---|
| PubChem CID | 142397468 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 3-(8a-hydroxy-1,2-dimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl)-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1C12CCCCC1(O)C(C)N(C)CC2 |
| InChI | InChI=1S/C19H27NO3/c1-13-6-7-15(17(21)22)12-16(13)18-8-4-5-9-19(18,23)14(2)20(3)11-10-18/h6-7,12,14,23H,4-5,8-11H2,1-3H3,(H,21,22) |
| InChIKey | MLWPOIJYXAJUFI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |