C17H21NO3 — CID 135196216
(9R,10S)-10-hydroxy-16-methyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-4-carboxylic acid (PubChem CID 135196216) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (9R,10S)-10-hydroxy-16-methyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-4-carboxylic acid.
| Compound Name | (9R,10S)-10-hydroxy-16-methyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 135196216 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (9R,10S)-10-hydroxy-16-methyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-triene-4-carboxylic acid |
| SMILES | CN1CCC23CCC[C@@]2(O)[C@H]1Cc1ccc(C(=O)O)cc13 |
| InChI | InChI=1S/C17H21NO3/c1-18-8-7-16-5-2-6-17(16,21)14(18)10-11-3-4-12(15(19)20)9-13(11)16/h3-4,9,14,21H,2,5-8,10H2,1H3,(H,19,20)/t14-,16?,17-/m1/s1 |
| InChIKey | KFWHFMZPUKMEFN-NZIKIWFDSA-N |
| XLogP | 1.80 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |