C17H19NO4 — CID 89253290
(1R,10R,11S)-4,11-dihydroxy-18-methyl-6-oxa-18-azapentacyclo[8.5.3.01,11.02,8.05,7]octadeca-2,4,7-trien-14-one (PubChem CID 89253290) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is (1R,10R,11S)-4,11-dihydroxy-18-methyl-6-oxa-18-azapentacyclo[8.5.3.01,11.02,8.05,7]octadeca-2,4,7-trien-14-one.
| Compound Name | (1R,10R,11S)-4,11-dihydroxy-18-methyl-6-oxa-18-azapentacyclo[8.5.3.01,11.02,8.05,7]octadeca-2,4,7-trien-14-one |
|---|---|
| PubChem CID | 89253290 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (1R,10R,11S)-4,11-dihydroxy-18-methyl-6-oxa-18-azapentacyclo[8.5.3.01,11.02,8.05,7]octadeca-2,4,7-trien-14-one |
| SMILES | CN1CC[C@]23CC(=O)CC[C@@]2(O)[C@H]1Cc1c3cc(O)c2c1O2 |
| InChI | InChI=1S/C17H19NO4/c1-18-5-4-16-8-9(19)2-3-17(16,21)13(18)6-10-11(16)7-12(20)15-14(10)22-15/h7,13,20-21H,2-6,8H2,1H3/t13-,16-,17-/m1/s1 |
| InChIKey | DLKMVIQULDYIRE-KBRIMQKVSA-N |
| XLogP | 1.48 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|