C19H24ClNO3 — CID 6916444
(1S,9S,10S)-4,10-dihydroxy-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride (PubChem CID 6916444) has the molecular formula C19H24ClNO3 and a molecular weight of 349.86 g/mol. Its IUPAC name is (1S,9S,10S)-4,10-dihydroxy-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride.
| Compound Name | (1S,9S,10S)-4,10-dihydroxy-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride |
|---|---|
| PubChem CID | 6916444 |
| Molecular Formula | C19H24ClNO3 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (1S,9S,10S)-4,10-dihydroxy-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride |
| SMILES | C=CCN1CC[C@@]23CC(=O)CC[C@@]2(O)[C@@H]1Cc1ccc(O)cc13.Cl |
| InChI | InChI=1S/C19H23NO3.ClH/c1-2-8-20-9-7-18-12-15(22)5-6-19(18,23)17(20)10-13-3-4-14(21)11-16(13)18;/h2-4,11,17,21,23H,1,5-10,12H2;1H/t17-,18-,19+;/m0./s1 |
| InChIKey | DEVUJNGSWZDECO-OXJRKUMDSA-N |
| XLogP | 2.35 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|