C20H25NO3 — CID 13145944
(1R,9R,10S)-10-hydroxy-3-methoxy-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one (PubChem CID 13145944) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (1R,9R,10S)-10-hydroxy-3-methoxy-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one.
| Compound Name | (1R,9R,10S)-10-hydroxy-3-methoxy-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
|---|---|
| PubChem CID | 13145944 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (1R,9R,10S)-10-hydroxy-3-methoxy-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
| SMILES | C=CCN1CC[C@]23CC(=O)CC[C@@]2(O)[C@H]1Cc1cccc(OC)c13 |
| InChI | InChI=1S/C20H25NO3/c1-3-10-21-11-9-19-13-15(22)7-8-20(19,23)17(21)12-14-5-4-6-16(24-2)18(14)19/h3-6,17,23H,1,7-13H2,2H3/t17-,19-,20-/m1/s1 |
| InChIKey | FHSGIWCXRGXYGB-MISYRCLQSA-N |
| XLogP | 2.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|