C20H24NO7P — CID 10387449
[(4aS,7aR,12bS)-4a-hydroxy-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] methyl hydrogen phosphate (PubChem CID 10387449) has the molecular formula C20H24NO7P and a molecular weight of 421.39 g/mol. Its IUPAC name is [(4aS,7aR,12bS)-4a-hydroxy-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] methyl hydrogen phosphate.
| Compound Name | [(4aS,7aR,12bS)-4a-hydroxy-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 10387449 |
| Molecular Formula | C20H24NO7P |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [(4aS,7aR,12bS)-4a-hydroxy-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] methyl hydrogen phosphate |
| SMILES | C=CCN1CC[C@]23c4c5ccc(OP(=O)(O)OC)c4O[C@H]2C(=O)CC[C@@]3(O)C1C5 |
| InChI | InChI=1S/C20H24NO7P/c1-3-9-21-10-8-19-16-12-4-5-14(28-29(24,25)26-2)17(16)27-18(19)13(22)6-7-20(19,23)15(21)11-12/h3-5,15,18,23H,1,6-11H2,2H3,(H,24,25)/t15?,18-,19-,20+/m0/s1 |
| InChIKey | VNHQDIBXQFUHTM-VCPZZJCDSA-N |
| XLogP | 1.72 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|