C19H22NO7P — CID 10341327
[(4aS,7aR,12bS)-4a-hydroxy-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] dihydrogen phosphate (PubChem CID 10341327) has the molecular formula C19H22NO7P and a molecular weight of 407.36 g/mol. Its IUPAC name is [(4aS,7aR,12bS)-4a-hydroxy-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] dihydrogen phosphate.
| Compound Name | [(4aS,7aR,12bS)-4a-hydroxy-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10341327 |
| Molecular Formula | C19H22NO7P |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [(4aS,7aR,12bS)-4a-hydroxy-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] dihydrogen phosphate |
| SMILES | C=CCN1CC[C@]23c4c5ccc(OP(=O)(O)O)c4O[C@H]2C(=O)CC[C@@]3(O)C1C5 |
| InChI | InChI=1S/C19H22NO7P/c1-2-8-20-9-7-18-15-11-3-4-13(27-28(23,24)25)16(15)26-17(18)12(21)5-6-19(18,22)14(20)10-11/h2-4,14,17,22H,1,5-10H2,(H2,23,24,25)/t14?,17-,18-,19+/m0/s1 |
| InChIKey | VTIRDFQSBLMPCN-BIAVLDQUSA-N |
| XLogP | 1.07 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|