C26H31NO4 — CID 154733660
(1R,9R,10S)-3-ethoxy-10-hydroxy-17-methyl-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one (PubChem CID 154733660) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is (1R,9R,10S)-3-ethoxy-10-hydroxy-17-methyl-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one.
| Compound Name | (1R,9R,10S)-3-ethoxy-10-hydroxy-17-methyl-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
|---|---|
| PubChem CID | 154733660 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (1R,9R,10S)-3-ethoxy-10-hydroxy-17-methyl-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
| SMILES | CCOc1c(OCc2ccccc2)ccc2c1[C@]13CCN(C)[C@H](C2)[C@]1(O)CCC(=O)C3 |
| InChI | InChI=1S/C26H31NO4/c1-3-30-24-21(31-17-18-7-5-4-6-8-18)10-9-19-15-22-26(29)12-11-20(28)16-25(26,23(19)24)13-14-27(22)2/h4-10,22,29H,3,11-17H2,1-2H3/t22-,25-,26-/m1/s1 |
| InChIKey | DTWXWXDRZMEGCL-DNRSQYFGSA-N |
| XLogP | 3.65 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |