C25H29NO4 — CID 22489683
(1S,10S)-3-hydroxy-4-methoxy-17-methyl-10-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one (PubChem CID 22489683) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is (1S,10S)-3-hydroxy-4-methoxy-17-methyl-10-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one.
| Compound Name | (1S,10S)-3-hydroxy-4-methoxy-17-methyl-10-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
|---|---|
| PubChem CID | 22489683 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (1S,10S)-3-hydroxy-4-methoxy-17-methyl-10-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
| SMILES | COc1ccc2c(c1O)[C@@]13CCN(C)C(C2)[C@]1(OCc1ccccc1)CCC(=O)C3 |
| InChI | InChI=1S/C25H29NO4/c1-26-13-12-24-15-19(27)10-11-25(24,30-16-17-6-4-3-5-7-17)21(26)14-18-8-9-20(29-2)23(28)22(18)24/h3-9,21,28H,10-16H2,1-2H3/t21?,24-,25+/m0/s1 |
| InChIKey | KPKKUMFKQWAULF-DYCCLRLQSA-N |
| XLogP | 3.61 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |