C25H29NO3 — CID 24840160
(1S,9R,10R)-4-methoxy-17-methyl-3-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one (PubChem CID 24840160) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is (1S,9R,10R)-4-methoxy-17-methyl-3-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one.
| Compound Name | (1S,9R,10R)-4-methoxy-17-methyl-3-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
|---|---|
| PubChem CID | 24840160 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (1S,9R,10R)-4-methoxy-17-methyl-3-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
| SMILES | COc1ccc2c(c1OCc1ccccc1)[C@]13CCN(C)[C@H](C2)[C@@H]1CCC(=O)C3 |
| InChI | InChI=1S/C25H29NO3/c1-26-13-12-25-15-19(27)9-10-20(25)21(26)14-18-8-11-22(28-2)24(23(18)25)29-16-17-6-4-3-5-7-17/h3-8,11,20-21H,9-10,12-16H2,1-2H3/t20-,21+,25-/m0/s1 |
| InChIKey | VTVLNPPGKSXPNL-BKSPAHHJSA-N |
| XLogP | 4.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |