C26H31NO4 — CID 139082035
(1R,9S,10S,13S)-4,12-dimethoxy-17-methyl-3-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-ol (PubChem CID 139082035) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is (1R,9S,10S,13S)-4,12-dimethoxy-17-methyl-3-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-ol.
| Compound Name | (1R,9S,10S,13S)-4,12-dimethoxy-17-methyl-3-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-ol |
|---|---|
| PubChem CID | 139082035 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (1R,9S,10S,13S)-4,12-dimethoxy-17-methyl-3-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-ol |
| SMILES | COC1=C[C@@H]2[C@@H]3Cc4ccc(OC)c(OCc5ccccc5)c4[C@]2(CCN3C)C[C@@H]1O |
| InChI | InChI=1S/C26H31NO4/c1-27-12-11-26-15-21(28)23(30-3)14-19(26)20(27)13-18-9-10-22(29-2)25(24(18)26)31-16-17-7-5-4-6-8-17/h4-10,14,19-21,28H,11-13,15-16H2,1-3H3/t19-,20+,21+,26-/m1/s1 |
| InChIKey | ZXMSDSORKLLALQ-VSCPTIONSA-N |
| XLogP | 3.68 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |