C19H24INO4 — CID 71583128
(1R,9S,10S,13S)-6-iodo-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraene-3,13-diol (PubChem CID 71583128) has the molecular formula C19H24INO4 and a molecular weight of 457.31 g/mol. Its IUPAC name is (1R,9S,10S,13S)-6-iodo-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraene-3,13-diol.
| Compound Name | (1R,9S,10S,13S)-6-iodo-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraene-3,13-diol |
|---|---|
| PubChem CID | 71583128 |
| Molecular Formula | C19H24INO4 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | (1R,9S,10S,13S)-6-iodo-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraene-3,13-diol |
| SMILES | COC1=C[C@@H]2[C@@H]3Cc4c(I)cc(OC)c(O)c4[C@]2(CCN3C)C[C@@H]1O |
| InChI | InChI=1S/C19H24INO4/c1-21-5-4-19-9-14(22)15(24-2)7-11(19)13(21)6-10-12(20)8-16(25-3)18(23)17(10)19/h7-8,11,13-14,22-23H,4-6,9H2,1-3H3/t11-,13+,14+,19-/m1/s1 |
| InChIKey | VWSCKNPUENSRGE-ADVCWENDSA-N |
| XLogP | 2.41 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|