C20H27NO4 — CID 59245056
(1R)-4,12,13-trimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol (PubChem CID 59245056) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (1R)-4,12,13-trimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol.
| Compound Name | (1R)-4,12,13-trimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol |
|---|---|
| PubChem CID | 59245056 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (1R)-4,12,13-trimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol |
| SMILES | COC1=CC2C3Cc4ccc(OC)c(O)c4[C@]2(CCN3C)CC1OC |
| InChI | InChI=1S/C20H27NO4/c1-21-8-7-20-11-17(25-4)16(24-3)10-13(20)14(21)9-12-5-6-15(23-2)19(22)18(12)20/h5-6,10,13-14,17,22H,7-9,11H2,1-4H3/t13?,14?,17?,20-/m1/s1 |
| InChIKey | ALWBGBFEEOOPLO-ALYLOJQJSA-N |
| XLogP | 2.46 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |