C21H31NO5 — CID 59245066
(1R)-4,12,12,13-tetramethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-ol (PubChem CID 59245066) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is (1R)-4,12,12,13-tetramethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-ol.
| Compound Name | (1R)-4,12,12,13-tetramethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-ol |
|---|---|
| PubChem CID | 59245066 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | (1R)-4,12,12,13-tetramethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-ol |
| SMILES | COc1ccc2c(c1O)[C@@]13CCN(C)C(C2)C1CC(OC)(OC)C(OC)C3 |
| InChI | InChI=1S/C21H31NO5/c1-22-9-8-20-12-17(25-3)21(26-4,27-5)11-14(20)15(22)10-13-6-7-16(24-2)19(23)18(13)20/h6-7,14-15,17,23H,8-12H2,1-5H3/t14?,15?,17?,20-/m1/s1 |
| InChIKey | QKHZJARNPVKGBK-IDQKJFIUSA-N |
| XLogP | 2.31 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|