C25H37NO2 — CID 10691388
(1R,9R,10R)-13-(cyclohexylmethyl)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-ol (PubChem CID 10691388) has the molecular formula C25H37NO2 and a molecular weight of 383.58 g/mol. Its IUPAC name is (1R,9R,10R)-13-(cyclohexylmethyl)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-ol.
| Compound Name | (1R,9R,10R)-13-(cyclohexylmethyl)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-ol |
|---|---|
| PubChem CID | 10691388 |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | (1R,9R,10R)-13-(cyclohexylmethyl)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-ol |
| SMILES | COc1ccc2c(c1O)[C@]13CCN(C)[C@H](C2)[C@@H]1CCC(CC1CCCCC1)C3 |
| InChI | InChI=1S/C25H37NO2/c1-26-13-12-25-16-18(14-17-6-4-3-5-7-17)8-10-20(25)21(26)15-19-9-11-22(28-2)24(27)23(19)25/h9,11,17-18,20-21,27H,3-8,10,12-16H2,1-2H3/t18?,20-,21+,25-/m0/s1 |
| InChIKey | GFJJZOXAJASYAL-YESDNZHZSA-N |
| XLogP | 5.29 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |