C20H27NO3 — CID 98474963
(1S,9S,10S,12R)-12-ethyl-3-hydroxy-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one (PubChem CID 98474963) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (1S,9S,10S,12R)-12-ethyl-3-hydroxy-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one.
| Compound Name | (1S,9S,10S,12R)-12-ethyl-3-hydroxy-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
|---|---|
| PubChem CID | 98474963 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (1S,9S,10S,12R)-12-ethyl-3-hydroxy-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
| SMILES | CC[C@@H]1C[C@@H]2[C@@H]3Cc4ccc(OC)c(O)c4[C@@]2(CCN3C)CC1=O |
| InChI | InChI=1S/C20H27NO3/c1-4-12-9-14-15-10-13-5-6-17(24-3)19(23)18(13)20(14,11-16(12)22)7-8-21(15)2/h5-6,12,14-15,23H,4,7-11H2,1-3H3/t12-,14-,15+,20+/m1/s1 |
| InChIKey | ZARLWULEOJBSIC-AUKZQPGHSA-N |
| XLogP | 2.90 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |