C20H27NO3 — CID 126538548
(1S,9S,10S)-4,12-dimethoxy-13,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol (PubChem CID 126538548) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (1S,9S,10S)-4,12-dimethoxy-13,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol.
| Compound Name | (1S,9S,10S)-4,12-dimethoxy-13,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol |
|---|---|
| PubChem CID | 126538548 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (1S,9S,10S)-4,12-dimethoxy-13,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol |
| SMILES | COC1=C[C@@H]2[C@@H]3Cc4ccc(OC)c(O)c4[C@]2(CCN3C)CC1C |
| InChI | InChI=1S/C20H27NO3/c1-12-11-20-7-8-21(2)15(14(20)10-17(12)24-4)9-13-5-6-16(23-3)19(22)18(13)20/h5-6,10,12,14-15,22H,7-9,11H2,1-4H3/t12?,14-,15+,20-/m1/s1 |
| InChIKey | WJAKJYGTMWMUDB-XHOUOSIJSA-N |
| XLogP | 3.09 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |