C19H26N2O3 — CID 21456199
(1R,9R,10R)-13-amino-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol (PubChem CID 21456199) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (1R,9R,10R)-13-amino-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol.
| Compound Name | (1R,9R,10R)-13-amino-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol |
|---|---|
| PubChem CID | 21456199 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (1R,9R,10R)-13-amino-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol |
| SMILES | COC1=C[C@H]2[C@H]3Cc4ccc(OC)c(O)c4[C@]2(CCN3C)CC1N |
| InChI | InChI=1S/C19H26N2O3/c1-21-7-6-19-10-13(20)16(24-3)9-12(19)14(21)8-11-4-5-15(23-2)18(22)17(11)19/h4-5,9,12-14,22H,6-8,10,20H2,1-3H3/t12-,13?,14+,19+/m0/s1 |
| InChIKey | UJZXUEISLARNTC-MUCNJBFUSA-N |
| XLogP | 1.78 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |