C26H29F3N2O4 — CID 72710098
(1R,9S,10S)-4,12-dimethoxy-17-methyl-13-[4-(trifluoromethoxy)anilino]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol (PubChem CID 72710098) has the molecular formula C26H29F3N2O4 and a molecular weight of 490.52 g/mol. Its IUPAC name is (1R,9S,10S)-4,12-dimethoxy-17-methyl-13-[4-(trifluoromethoxy)anilino]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol.
| Compound Name | (1R,9S,10S)-4,12-dimethoxy-17-methyl-13-[4-(trifluoromethoxy)anilino]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol |
|---|---|
| PubChem CID | 72710098 |
| Molecular Formula | C26H29F3N2O4 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | (1R,9S,10S)-4,12-dimethoxy-17-methyl-13-[4-(trifluoromethoxy)anilino]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-ol |
| SMILES | COC1=C[C@@H]2[C@@H]3Cc4ccc(OC)c(O)c4[C@]2(CCN3C)CC1Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H29F3N2O4/c1-31-11-10-25-14-19(30-16-5-7-17(8-6-16)35-26(27,28)29)22(34-3)13-18(25)20(31)12-15-4-9-21(33-2)24(32)23(15)25/h4-9,13,18-20,30,32H,10-12,14H2,1-3H3/t18-,19?,20+,25-/m1/s1 |
| InChIKey | PPGPXBIMXSNYSL-JJMIXANDSA-N |
| XLogP | 4.83 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|